![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 2105A-non-permission.pdf | 2020-10-20 15:09 | 58K | |
![[ ]](/icons/layout.gif) | 2105A-talentrelease.pdf | 2020-10-20 15:09 | 63K | |
![[ ]](/icons/layout.gif) | 2215-alcoholicBevSvcReqForm.pdf | 2020-10-20 15:09 | 30K | |
![[ ]](/icons/layout.gif) | 2502_Academic_Integrity_Flowchart.pdf | 2022-09-15 13:35 | 479K | |
![[ ]](/icons/unknown.gif) | AI Flowchart.pptx | 2020-10-20 15:09 | 36K | |
![[ ]](/icons/unknown.gif) | Alternative Work Location Agreement.doc | 2024-02-19 19:19 | 46K | |
![[ ]](/icons/unknown.gif) | Annual Conflict of Interest Disclosure Form.docx | 2020-10-20 15:09 | 216K | |
![[ ]](/icons/layout.gif) | Annual Conflict of Interest Disclosure Form.pdf | 2020-10-20 15:09 | 46K | |
![[ ]](/icons/unknown.gif) | CWG_Application.docx | 2020-10-20 15:09 | 29K | |
![[ ]](/icons/layout.gif) | Computing Standards.pdf | 2022-12-08 15:25 | 590K | |
![[ ]](/icons/layout.gif) | Contractor vs Employee.pdf | 2022-08-26 20:24 | 215K | |
![[ ]](/icons/layout.gif) | Copyright_Flowchart.pdf | 2020-10-20 15:09 | 144K | |
![[ ]](/icons/unknown.gif) | Donated Leave Authorization Form.doc | 2020-10-20 15:09 | 26K | |
![[ ]](/icons/unknown.gif) | Drug-Free-Appendix.docx | 2020-10-20 15:09 | 57K | |
![[ ]](/icons/layout.gif) | Drug-Free-Appendix.pdf | 2021-10-01 19:26 | 954K | |
![[ ]](/icons/unknown.gif) | Drug-Free_Annual_Notification_Letter-Employee.docx | 2020-10-20 15:09 | 15K | |
![[ ]](/icons/layout.gif) | Drug-Free_Annual_Notification_Letter-Employee.pdf | 2024-09-26 22:44 | 150K | |
![[ ]](/icons/unknown.gif) | Drug-Free_Annual_Notification_Letter-Student.docx | 2020-10-20 15:09 | 15K | |
![[ ]](/icons/layout.gif) | Drug-Free_Annual_Notification_Letter-Student.pdf | 2024-09-26 22:44 | 137K | |
![[ ]](/icons/unknown.gif) | Early Retirement Letter Template.docx | 2024-08-12 18:01 | 29K | |
![[ ]](/icons/layout.gif) | Emergency_Contact_Missing_Student.pdf | 2021-09-01 14:23 | 629K | |
![[ ]](/icons/layout.gif) | Employee Position Codes Classes and Descriptions (3-27-19).pdf | 2023-07-10 13:07 | 83K | |
![[ ]](/icons/unknown.gif) | Finals Petition Form1.docx | 2024-05-14 12:37 | 19K | |
![[ ]](/icons/unknown.gif) | Finals_Petition_Form.docx | 2020-10-20 15:09 | 15K | |
![[ ]](/icons/layout.gif) | Information Security Roles and Responsibilities.pdf | 2022-12-08 15:19 | 598K | |
![[ ]](/icons/layout.gif) | Interview_Questions_for_Emotional_Intelligence.pdf | 2022-08-26 20:24 | 507K | |
![[ ]](/icons/unknown.gif) | Military Application for Reemployment (11-8-21).docx | 2021-11-08 20:28 | 20K | |
![[ ]](/icons/unknown.gif) | Military Request for Leave of Absence Form.docx | 2020-10-20 15:09 | 16K | |
![[ ]](/icons/layout.gif) | Personal_Reference_Questionnaire.pdf | 2022-08-26 20:24 | 407K | |
![[ ]](/icons/layout.gif) | Position Codes Classifications.pdf | 2023-06-01 11:23 | 59K | |
![[ ]](/icons/unknown.gif) | Problem Resolution Form.doc | 2020-10-20 15:09 | 26K | |
![[ ]](/icons/unknown.gif) | Problem Statement.doc | 2020-10-20 15:09 | 29K | |
![[ ]](/icons/unknown.gif) | Public Records Request Form.docx | 2020-10-20 15:09 | 13K | |
![[ ]](/icons/unknown.gif) | Purchase Order.doc | 2020-10-20 15:09 | 250K | |
![[ ]](/icons/unknown.gif) | Quick Checklist When Refilling Regular Positions.docx | 2020-10-20 15:09 | 18K | |
![[ ]](/icons/unknown.gif) | Quick_Checklist_When_Refilling_Adjunct_Faculty_Positions.docx | 2020-10-20 15:10 | 14K | |
![[ ]](/icons/unknown.gif) | Quick_Checklist_When_Refilling_Hourly_Staff_(Temporary)_Positions.docx | 2020-10-20 15:10 | 14K | |
![[ ]](/icons/unknown.gif) | Quick_Checklist_When_Refilling_Student_Employment_Positions.docx | 2020-10-20 15:10 | 14K | |
![[ ]](/icons/unknown.gif) | Resignation Letter Template.docx | 2024-08-12 18:01 | 29K | |
![[ ]](/icons/unknown.gif) | Retirement Letter Template.docx | 2024-08-12 18:01 | 29K | |
![[ ]](/icons/unknown.gif) | Sabbatical_Leave_Application_Form.docx | 2020-10-20 15:10 | 17K | |
![[ ]](/icons/unknown.gif) | Sole Source Justification Form.doc | 2023-03-13 13:55 | 307K | |
![[ ]](/icons/unknown.gif) | Student Employment Termination Memo - Fill-in Form.docx | 2020-10-20 15:10 | 12K | |
![[ ]](/icons/unknown.gif) | Student Employment Termination Memo.docx | 2020-10-20 15:10 | 12K | |
![[ ]](/icons/unknown.gif) | Student Employment Written Warning - Fill-in Form.docx | 2020-10-20 15:10 | 13K | |
![[ ]](/icons/unknown.gif) | Student Employment Written Warning.docx | 2020-10-20 15:10 | 13K | |
![[ ]](/icons/layout.gif) | Student_Employee_Supervision_Training_Course.pdf | 2022-08-26 20:24 | 387K | |
![[ ]](/icons/unknown.gif) | TRAVEL_REIMBURSEMENT_FORM.xlsx | 2021-10-11 19:51 | 2.0M | |
![[ ]](/icons/unknown.gif) | Transmittal Form.doc | 2020-10-20 15:10 | 68K | |
![[ ]](/icons/unknown.gif) | Travel Reimbursement Form.xlsx | 2023-04-12 13:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | Travel Reimbursement Form1.xlsx | 2024-09-30 12:47 | 2.0M | |
![[ ]](/icons/unknown.gif) | XF Form.doc | 2020-10-20 15:10 | 26K | |
![[ ]](/icons/unknown.gif) | catastrophic_illness_form.docx | 2020-10-20 15:09 | 30K | |
![[ ]](/icons/unknown.gif) | disclosure_of_additional_employment_form.docx | 2020-10-20 15:09 | 23K | |
![[ ]](/icons/layout.gif) | disclosure_of_additional_employment_form.pdf | 2020-10-20 15:09 | 144K | |
![[ ]](/icons/unknown.gif) | general_leave_of_absence_form.docx | 2024-08-19 20:13 | 30K | |
![[ ]](/icons/layout.gif) | interviewquestions.pdf | 2022-08-26 20:24 | 221K | |
![[ ]](/icons/layout.gif) | intervquesttableformat.pdf | 2022-08-26 20:24 | 19K | |
|