![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Employee_Handbook_1-23-25.pdf | 2025-01-23 19:49 | 452K | |
![[DIR]](/icons/folder.gif) | HRPayroll/ | 2024-10-01 20:25 | - | |
| Notice 24-08.pdf | 2024-08-30 15:54 | 160K | |
| Kansas Withholding Tax Guide - July 1 2024.pdf | 2024-08-30 15:54 | 1.8M | |
| K-4 2024.pdf | 2024-08-30 15:54 | 298K | |
| HRHiring/ | 2024-05-07 15:21 | - | |
| HRForms Center/ | 2024-02-20 13:58 | - | |
| HRNew Employee Information/ | 2023-07-25 18:31 | - | |
| hrdirectories/ | 2023-07-24 14:00 | - | |
| List of Policies & Procedures.pdf | 2023-05-31 18:31 | 236K | |
| Drug-Free Annual Notification Email-Employee.pdf | 2023-01-19 14:45 | 537K | |
![[ ]](/icons/unknown.gif) | Drug-Free Annual Notification Email-Employee - Shortcut.lnk | 2023-01-19 14:44 | 2.0K | |
| HRRecog & Work Anniv/ | 2022-09-23 20:43 | - | |
| Gift Card Tracking Spreadsheet.xlsx | 2022-05-11 20:24 | 11K | |
| Performance Appraisals/ | 2021-08-17 19:46 | - | |
| Hartford-Customer Privacy Notice.pdf | 2021-08-11 15:13 | 135K | |
| Salary Leave Report Guide 2021.pptx | 2021-07-29 13:57 | 9.6M | |
| Approver Guide - Timesheet 2021.pptx | 2021-07-26 14:39 | 7.7M | |
| Approver Guide - Leave Report 2021.pptx | 2021-07-26 14:39 | 7.8M | |
| Adjunct Faculty Assignment Pay Dates.pdf | 2020-11-12 19:37 | 395K | |
| TimeClock Plus/ | 2020-08-07 20:17 | - | |
| Portal/ | 2020-03-31 16:14 | - | |
| FFCRA_Poster_WH1422_Non-Federal.pdf | 2020-03-27 13:02 | 178K | |
| HRBenefits and Discounts/ | 2019-08-29 13:49 | - | |
| ADA Civil Rights.pdf | 2018-11-09 15:56 | 488K | |
| Barton Consumer Confidence 2018.pdf | 2018-11-09 15:17 | 282K | |
| HRProfessional Development/ | 2018-10-24 19:34 | - | |
| Volunteers/ | 2017-11-27 20:38 | - | |
| F.docx | 2017-10-25 16:15 | 12K | |
| FLAC/ | 2017-10-25 16:14 | - | |
| HRFAQs/ | 2017-05-15 12:01 | - | |
| Work Comp/ | 2016-11-22 19:22 | - | |
| HRPerformance Appraisals/ | 2016-11-22 19:22 | - | |
| HREmployee Recognition/ | 2016-11-22 19:22 | - | |
| Forms Center/ | 2016-11-22 19:22 | - | |
| 13-14 Final Audit.pdf | 2016-11-22 19:22 | 29M | |
| HRBloodborne Pathogens/ | 2016-11-22 19:22 | - | |
|
|---|