![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 5.A.1 2102 Institutional Planning and Effectiveness.pdf | 2022-10-11 16:18 | 147K | |
| 5.A.1 Board of Trustees.pdf | 2022-10-11 16:18 | 665K | |
| 5.A.1 BOT Embedded Minutes Example.pdf | 2022-10-11 16:18 | 115K | |
| 5.A.1 BOT Meeting Agendas and Minutes.pdf | 2022-10-11 16:18 | 394K | |
| 5.A.1 Carver Governance Model.pdf | 2022-10-11 16:18 | 528K | |
| 5.A.1 Deans Council Meeting Notes Example.pdf | 2022-10-11 16:18 | 239K | |
| 5.A.1 Example of Employee Comments to Proposed Policy Revision.pdf | 2022-10-11 16:18 | 250K | |
| 5.A.1 Faculty Council Charter.pdf | 2022-10-11 16:18 | 119K | |
| 5.A.1 Institutional Teams.pdf | 2022-10-11 16:18 | 87K | |
| 5.A.1 Institutional Trustee Recognition.pdf | 2022-10-11 16:18 | 216K | |
| 5.A.1 Kansas Association of Community College Trustees.pdf | 2022-10-11 16:18 | 208K | |
| 5.A.1 Kansas Statute 71.201.pdf | 2022-10-11 16:18 | 181K | |
| 5.A.1 Organizational Structure.pdf | 2022-10-11 16:18 | 96K | |
| 5.A.1 PTP Meeting Notes Example.pdf | 2022-10-11 16:18 | 263K | |
| 5.A.1 Regional Trustee Recognition.pdf | 2022-10-11 16:18 | 103K | |
| 5.A.1 State Trustee Recognition.pdf | 2022-10-11 16:18 | 205K | |
| 5.A.1 Taxpayer Accountability.pdf | 2022-10-11 16:18 | 206K | |
| 5.A.1 Team Charter Example.pdf | 2022-10-11 16:18 | 180K | |
|
|---|